C5H14Cl2O7P2 — CID 158379959
2,2-bis(hydroxymethyl)propane-1,3-diol;dichlorophosphanyl dihydrogen phosphite (PubChem CID 158379959) has the molecular formula C5H14Cl2O7P2 and a molecular weight of 319.01 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;dichlorophosphanyl dihydrogen phosphite.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;dichlorophosphanyl dihydrogen phosphite |
|---|---|
| PubChem CID | 158379959 |
| Molecular Formula | C5H14Cl2O7P2 |
| Molecular Weight | 319.01 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;dichlorophosphanyl dihydrogen phosphite |
| SMILES | OCC(CO)(CO)CO.OP(O)OP(Cl)Cl |
| InChI | InChI=1S/C5H12O4.Cl2H2O3P2/c6-1-5(2-7,3-8)4-9;1-6(2)5-7(3)4/h6-9H,1-4H2;3-4H |
| InChIKey | GVQXVEWHRFPTKO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.01 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|