C10H24O8Zn — CID 175286954
bis(2,2-bis(hydroxymethyl)propane-1,3-diol);zinc (PubChem CID 175286954) has the molecular formula C10H24O8Zn and a molecular weight of 337.68 g/mol. Its IUPAC name is bis(2,2-bis(hydroxymethyl)propane-1,3-diol);zinc.
| Compound Name | bis(2,2-bis(hydroxymethyl)propane-1,3-diol);zinc |
|---|---|
| PubChem CID | 175286954 |
| Molecular Formula | C10H24O8Zn |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | bis(2,2-bis(hydroxymethyl)propane-1,3-diol);zinc |
| SMILES | OCC(CO)(CO)CO.OCC(CO)(CO)CO.[Zn] |
| InChI | InChI=1S/2C5H12O4.Zn/c2*6-1-5(2-7,3-8)4-9;/h2*6-9H,1-4H2; |
| InChIKey | URYXHDSIOPFRDU-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|