C10H22Br2O6 — CID 157283280
2-(bromomethyl)-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 157283280) has the molecular formula C10H22Br2O6 and a molecular weight of 398.09 g/mol. Its IUPAC name is 2-(bromomethyl)-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-(bromomethyl)-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 157283280 |
| Molecular Formula | C10H22Br2O6 |
| Molecular Weight | 398.09 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 2-(bromomethyl)-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | OCC(CO)(CO)CBr.OCC(CO)(CO)CBr |
| InChI | InChI=1S/2C5H11BrO3/c2*6-1-5(2-7,3-8)4-9/h2*7-9H,1-4H2 |
| InChIKey | AZXRVOCCIHXZDZ-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.09 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|