C10H21Br3O5 — CID 131713024
2-(bromomethyl)-2-(hydroxymethyl)propane-1,3-diol;1,3-dibromo-2,2-dimethylpropane-1,3-diol (PubChem CID 131713024) has the molecular formula C10H21Br3O5 and a molecular weight of 460.99 g/mol. Its IUPAC name is 2-(bromomethyl)-2-(hydroxymethyl)propane-1,3-diol;1,3-dibromo-2,2-dimethylpropane-1,3-diol.
| Compound Name | 2-(bromomethyl)-2-(hydroxymethyl)propane-1,3-diol;1,3-dibromo-2,2-dimethylpropane-1,3-diol |
|---|---|
| PubChem CID | 131713024 |
| Molecular Formula | C10H21Br3O5 |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 457.89 |
| IUPAC Name | 2-(bromomethyl)-2-(hydroxymethyl)propane-1,3-diol;1,3-dibromo-2,2-dimethylpropane-1,3-diol |
| SMILES | CC(C)(C(O)Br)C(O)Br.OCC(CO)(CO)CBr |
| InChI | InChI=1S/C5H10Br2O2.C5H11BrO3/c1-5(2,3(6)8)4(7)9;6-1-5(2-7,3-8)4-9/h3-4,8-9H,1-2H3;7-9H,1-4H2 |
| InChIKey | DBSFOHHPRWIPGK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|