C15H36O8 — CID 118407726
2,2-bis(hydroxymethyl)propane-1,3-diol;bis(3-methylbutane-1,1-diol) (PubChem CID 118407726) has the molecular formula C15H36O8 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;bis(3-methylbutane-1,1-diol).
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;bis(3-methylbutane-1,1-diol) |
|---|---|
| PubChem CID | 118407726 |
| Molecular Formula | C15H36O8 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;bis(3-methylbutane-1,1-diol) |
| SMILES | CC(C)CC(O)O.CC(C)CC(O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.2C5H12O2/c6-1-5(2-7,3-8)4-9;2*1-4(2)3-5(6)7/h6-9H,1-4H2;2*4-7H,3H2,1-2H3 |
| InChIKey | YBHUXQIRXRMOFV-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|