C12H26O5 — CID 174493040
2-(hydroxymethyl)-2-[2-(4-hydroxy-2-methylpentoxy)ethyl]propane-1,3-diol (PubChem CID 174493040) has the molecular formula C12H26O5 and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[2-(4-hydroxy-2-methylpentoxy)ethyl]propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-[2-(4-hydroxy-2-methylpentoxy)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 174493040 |
| Molecular Formula | C12H26O5 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-(hydroxymethyl)-2-[2-(4-hydroxy-2-methylpentoxy)ethyl]propane-1,3-diol |
| SMILES | CC(O)CC(C)COCCC(CO)(CO)CO |
| InChI | InChI=1S/C12H26O5/c1-10(5-11(2)16)6-17-4-3-12(7-13,8-14)9-15/h10-11,13-16H,3-9H2,1-2H3 |
| InChIKey | WGECISVIPXSOTP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|