C13H28O4 — CID 159541601
2,2-bis(hydroxymethyl)propane-1,3-diol;2,3,4-trimethylpent-2-ene (PubChem CID 159541601) has the molecular formula C13H28O4 and a molecular weight of 248.36 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;2,3,4-trimethylpent-2-ene.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2,3,4-trimethylpent-2-ene |
|---|---|
| PubChem CID | 159541601 |
| Molecular Formula | C13H28O4 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2,3,4-trimethylpent-2-ene |
| SMILES | CC(C)=C(C)C(C)C.OCC(CO)(CO)CO |
| InChI | InChI=1S/C8H16.C5H12O4/c1-6(2)8(5)7(3)4;6-1-5(2-7,3-8)4-9/h6H,1-5H3;6-9H,1-4H2 |
| InChIKey | MEGZAFDYDNSYIB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|