C8H19O4PS — CID 162033862
sulfanyl dihydrogen phosphate;2,3,4-trimethylpent-2-ene (PubChem CID 162033862) has the molecular formula C8H19O4PS and a molecular weight of 242.28 g/mol. Its IUPAC name is sulfanyl dihydrogen phosphate;2,3,4-trimethylpent-2-ene.
| Compound Name | sulfanyl dihydrogen phosphate;2,3,4-trimethylpent-2-ene |
|---|---|
| PubChem CID | 162033862 |
| Molecular Formula | C8H19O4PS |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | sulfanyl dihydrogen phosphate;2,3,4-trimethylpent-2-ene |
| SMILES | CC(C)=C(C)C(C)C.O=P(O)(O)OS |
| InChI | InChI=1S/C8H16.H3O4PS/c1-6(2)8(5)7(3)4;1-5(2,3)4-6/h6H,1-5H3;6H,(H2,1,2,3) |
| InChIKey | YWJROJNYPSTQJI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|