C15H34O9P2 — CID 90697743
[2-(dihydroxyphosphanyloxymethyl)-2-(hydroxymethyl)-3-(8-methylnonylperoxy)propyl] dihydrogen phosphite (PubChem CID 90697743) has the molecular formula C15H34O9P2 and a molecular weight of 420.38 g/mol. Its IUPAC name is [2-(dihydroxyphosphanyloxymethyl)-2-(hydroxymethyl)-3-(8-methylnonylperoxy)propyl] dihydrogen phosphite.
| Compound Name | [2-(dihydroxyphosphanyloxymethyl)-2-(hydroxymethyl)-3-(8-methylnonylperoxy)propyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 90697743 |
| Molecular Formula | C15H34O9P2 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-(dihydroxyphosphanyloxymethyl)-2-(hydroxymethyl)-3-(8-methylnonylperoxy)propyl] dihydrogen phosphite |
| SMILES | CC(C)CCCCCCCOOCC(CO)(COP(O)O)COP(O)O |
| InChI | InChI=1S/C15H34O9P2/c1-14(2)8-6-4-3-5-7-9-21-22-11-15(10-16,12-23-25(17)18)13-24-26(19)20/h14,16-20H,3-13H2,1-2H3 |
| InChIKey | VPWFQRBODQNTBU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|