About phosphorous acid;tris(6-methylheptyl) phosphite
phosphorous acid;tris(6-methylheptyl) phosphite (PubChem CID 87841257) has the molecular formula C24H54O6P2
and a molecular weight of 500.64 g/mol. Its IUPAC name is phosphorous acid;tris(6-methylheptyl) phosphite.
Molecular Properties
| Compound Name | phosphorous acid;tris(6-methylheptyl) phosphite |
| PubChem CID | 87841257 |
| Molecular Formula | C24H54O6P2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | phosphorous acid;tris(6-methylheptyl) phosphite |
| SMILES | CC(C)CCCCCOP(OCCCCCC(C)C)OCCCCCC(C)C.OP(O)O |
| InChI | InChI=1S/C24H51O3P.H3O3P/c1-22(2)16-10-7-13-19-25-28(26-20-14-8-11-17-23(3)4)27-21-15-9-12-18-24(5)6;1-4(2)3/h22-24H,7-21H2,1-6H3;1-3H |
| InChIKey | MIDWWRLYQJOQQZ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphorous acid;tris(6-methylheptyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphorous acid;tris(6-methylheptyl) phosphite?
The IUPAC name of phosphorous acid;tris(6-methylheptyl) phosphite (CID 87841257) is phosphorous acid;tris(6-methylheptyl) phosphite.
What is the SMILES notation for phosphorous acid;tris(6-methylheptyl) phosphite?
The canonical SMILES for phosphorous acid;tris(6-methylheptyl) phosphite is CC(C)CCCCCOP(OCCCCCC(C)C)OCCCCCC(C)C.OP(O)O.
What is the InChIKey of phosphorous acid;tris(6-methylheptyl) phosphite?
The InChIKey is MIDWWRLYQJOQQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51O3P.H3O3P/c1-22(2)16-10-7-13-19-25-28(26-20-14-8-11-17-23(3)4)27-21-15-9-12-18-24(5)6;1-4(2)3/h22-24H,7-21H2,1-6H3;1-3H.
What are the key properties of phosphorous acid;tris(6-methylheptyl) phosphite?
phosphorous acid;tris(6-methylheptyl) phosphite has a molecular weight of 500.64 g/mol, XLogP of 8.10, 21 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phosphorous acid;tris(6-methylheptyl) phosphite is sourced from PubChem (CID 87841257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).