About dihydroxyphosphanyl bis(8-methylnonoxy) phosphite
dihydroxyphosphanyl bis(8-methylnonoxy) phosphite (PubChem CID 141008258) has the molecular formula C20H44O7P2
and a molecular weight of 458.51 g/mol. Its IUPAC name is dihydroxyphosphanyl bis(8-methylnonoxy) phosphite.
Molecular Properties
| Compound Name | dihydroxyphosphanyl bis(8-methylnonoxy) phosphite |
| PubChem CID | 141008258 |
| Molecular Formula | C20H44O7P2 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | dihydroxyphosphanyl bis(8-methylnonoxy) phosphite |
| SMILES | CC(C)CCCCCCCOOP(OOCCCCCCCC(C)C)OP(O)O |
| InChI | InChI=1S/C20H44O7P2/c1-19(2)15-11-7-5-9-13-17-23-25-29(27-28(21)22)26-24-18-14-10-6-8-12-16-20(3)4/h19-22H,5-18H2,1-4H3 |
| InChIKey | FYCKTIFXRVEDRT-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxyphosphanyl bis(8-methylnonoxy) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxyphosphanyl bis(8-methylnonoxy) phosphite?
The IUPAC name of dihydroxyphosphanyl bis(8-methylnonoxy) phosphite (CID 141008258) is dihydroxyphosphanyl bis(8-methylnonoxy) phosphite.
What is the SMILES notation for dihydroxyphosphanyl bis(8-methylnonoxy) phosphite?
The canonical SMILES for dihydroxyphosphanyl bis(8-methylnonoxy) phosphite is CC(C)CCCCCCCOOP(OOCCCCCCCC(C)C)OP(O)O.
What is the InChIKey of dihydroxyphosphanyl bis(8-methylnonoxy) phosphite?
The InChIKey is FYCKTIFXRVEDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H44O7P2/c1-19(2)15-11-7-5-9-13-17-23-25-29(27-28(21)22)26-24-18-14-10-6-8-12-16-20(3)4/h19-22H,5-18H2,1-4H3.
What are the key properties of dihydroxyphosphanyl bis(8-methylnonoxy) phosphite?
dihydroxyphosphanyl bis(8-methylnonoxy) phosphite has a molecular weight of 458.51 g/mol, XLogP of 7.33, 22 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxyphosphanyl bis(8-methylnonoxy) phosphite is sourced from PubChem (CID 141008258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).