About [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite
[hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite (PubChem CID 88626572) has the molecular formula C16H36O5P2
and a molecular weight of 370.41 g/mol. Its IUPAC name is [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite.
Molecular Properties
| Compound Name | [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite |
| PubChem CID | 88626572 |
| Molecular Formula | C16H36O5P2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite |
| SMILES | CC(C)CCCCCOP(O)OP(O)OCCCCCC(C)C |
| InChI | InChI=1S/C16H36O5P2/c1-15(2)11-7-5-9-13-19-22(17)21-23(18)20-14-10-6-8-12-16(3)4/h15-18H,5-14H2,1-4H3 |
| InChIKey | ZPYMLWASYJECBT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite?
The IUPAC name of [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite (CID 88626572) is [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite.
What is the SMILES notation for [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite?
The canonical SMILES for [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite is CC(C)CCCCCOP(O)OP(O)OCCCCCC(C)C.
What is the InChIKey of [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite?
The InChIKey is ZPYMLWASYJECBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36O5P2/c1-15(2)11-7-5-9-13-19-22(17)21-23(18)20-14-10-6-8-12-16(3)4/h15-18H,5-14H2,1-4H3.
What are the key properties of [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite?
[hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite has a molecular weight of 370.41 g/mol, XLogP of 5.91, 16 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [hydroxy(6-methylheptoxy)phosphanyl] 6-methylheptyl hydrogen phosphite is sourced from PubChem (CID 88626572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).