About 6-ethyloctyl dihydrogen phosphite
6-ethyloctyl dihydrogen phosphite (PubChem CID 141350214) has the molecular formula C10H23O3P
and a molecular weight of 222.26 g/mol. Its IUPAC name is 6-ethyloctyl dihydrogen phosphite.
Molecular Properties
| Compound Name | 6-ethyloctyl dihydrogen phosphite |
| PubChem CID | 141350214 |
| Molecular Formula | C10H23O3P |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 6-ethyloctyl dihydrogen phosphite |
| SMILES | CCC(CC)CCCCCOP(O)O |
| InChI | InChI=1S/C10H23O3P/c1-3-10(4-2)8-6-5-7-9-13-14(11)12/h10-12H,3-9H2,1-2H3 |
| InChIKey | UNVYVXPIXGFBML-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyloctyl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyloctyl dihydrogen phosphite?
The IUPAC name of 6-ethyloctyl dihydrogen phosphite (CID 141350214) is 6-ethyloctyl dihydrogen phosphite.
What is the SMILES notation for 6-ethyloctyl dihydrogen phosphite?
The canonical SMILES for 6-ethyloctyl dihydrogen phosphite is CCC(CC)CCCCCOP(O)O.
What is the InChIKey of 6-ethyloctyl dihydrogen phosphite?
The InChIKey is UNVYVXPIXGFBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23O3P/c1-3-10(4-2)8-6-5-7-9-13-14(11)12/h10-12H,3-9H2,1-2H3.
What are the key properties of 6-ethyloctyl dihydrogen phosphite?
6-ethyloctyl dihydrogen phosphite has a molecular weight of 222.26 g/mol, XLogP of 3.21, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyloctyl dihydrogen phosphite is sourced from PubChem (CID 141350214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).