About lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride
lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride (PubChem CID 173436132) has the molecular formula C20H44LiO3P
and a molecular weight of 370.48 g/mol. Its IUPAC name is lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride.
Molecular Properties
| Compound Name | lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride |
| PubChem CID | 173436132 |
| Molecular Formula | C20H44LiO3P |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride |
| SMILES | CCCCCCC(CC)COP(O)OCC(CC)CCCCCC.[H-].[Li+] |
| InChI | InChI=1S/C20H43O3P.Li.H/c1-5-9-11-13-15-19(7-3)17-22-24(21)23-18-20(8-4)16-14-12-10-6-2;;/h19-21H,5-18H2,1-4H3;;/q;+1;-1 |
| InChIKey | RBRHLWGDRUDJAM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride?
The IUPAC name of lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride (CID 173436132) is lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride.
What is the SMILES notation for lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride?
The canonical SMILES for lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride is CCCCCCC(CC)COP(O)OCC(CC)CCCCCC.[H-].[Li+].
What is the InChIKey of lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride?
The InChIKey is RBRHLWGDRUDJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43O3P.Li.H/c1-5-9-11-13-15-19(7-3)17-22-24(21)23-18-20(8-4)16-14-12-10-6-2;;/h19-21H,5-18H2,1-4H3;;/q;+1;-1.
What are the key properties of lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride?
lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride has a molecular weight of 370.48 g/mol, XLogP of 4.35, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride is sourced from PubChem (CID 173436132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).