lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride

C20H44LiO3P — CID 173436132

IUPAClithium;bis(2-ethyloctyl) hydrogen phosphite;hydride
SMILESCCCCCCC(CC)COP(O)OCC(CC)CCCCCC.[H-].[Li+]
InChIInChI=1S/C20H43O3P.Li.H/c1-5-9-11-13-15-19(7-3)17-22-24(21)23-18-20(8-4)16-14-12-10-6-2;;/h19-21H,5-18H2,1-4H3;;/q;+1;-1
InChIKeyRBRHLWGDRUDJAM-UHFFFAOYSA-N
MW370.48 g/mol
LogP4.35
Rot. Bonds18

About lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride

lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride (PubChem CID 173436132) has the molecular formula C20H44LiO3P and a molecular weight of 370.48 g/mol. Its IUPAC name is lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride.

Molecular Properties

Compound Namelithium;bis(2-ethyloctyl) hydrogen phosphite;hydride
PubChem CID173436132
Molecular FormulaC20H44LiO3P
Molecular Weight370.48 g/mol
Exact Mass370.32
IUPAC Namelithium;bis(2-ethyloctyl) hydrogen phosphite;hydride
SMILESCCCCCCC(CC)COP(O)OCC(CC)CCCCCC.[H-].[Li+]
InChIInChI=1S/C20H43O3P.Li.H/c1-5-9-11-13-15-19(7-3)17-22-24(21)23-18-20(8-4)16-14-12-10-6-2;;/h19-21H,5-18H2,1-4H3;;/q;+1;-1
InChIKeyRBRHLWGDRUDJAM-UHFFFAOYSA-N
XLogP4.35
TPSA38.69 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds18
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500370.48
LogP ≤ 54.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride?
The IUPAC name of lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride (CID 173436132) is lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride.
What is the SMILES notation for lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride?
The canonical SMILES for lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride is CCCCCCC(CC)COP(O)OCC(CC)CCCCCC.[H-].[Li+].
What is the InChIKey of lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride?
The InChIKey is RBRHLWGDRUDJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43O3P.Li.H/c1-5-9-11-13-15-19(7-3)17-22-24(21)23-18-20(8-4)16-14-12-10-6-2;;/h19-21H,5-18H2,1-4H3;;/q;+1;-1.
What are the key properties of lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride?
lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride has a molecular weight of 370.48 g/mol, XLogP of 4.35, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;bis(2-ethyloctyl) hydrogen phosphite;hydride is sourced from PubChem (CID 173436132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).