About 2-propylheptyl dihydrogen phosphite
2-propylheptyl dihydrogen phosphite (PubChem CID 87359174) has the molecular formula C10H23O3P
and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-propylheptyl dihydrogen phosphite.
Molecular Properties
| Compound Name | 2-propylheptyl dihydrogen phosphite |
| PubChem CID | 87359174 |
| Molecular Formula | C10H23O3P |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-propylheptyl dihydrogen phosphite |
| SMILES | CCCCCC(CCC)COP(O)O |
| InChI | InChI=1S/C10H23O3P/c1-3-5-6-8-10(7-4-2)9-13-14(11)12/h10-12H,3-9H2,1-2H3 |
| InChIKey | AHQDKTVCIMHNFT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-propylheptyl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylheptyl dihydrogen phosphite?
The IUPAC name of 2-propylheptyl dihydrogen phosphite (CID 87359174) is 2-propylheptyl dihydrogen phosphite.
What is the SMILES notation for 2-propylheptyl dihydrogen phosphite?
The canonical SMILES for 2-propylheptyl dihydrogen phosphite is CCCCCC(CCC)COP(O)O.
What is the InChIKey of 2-propylheptyl dihydrogen phosphite?
The InChIKey is AHQDKTVCIMHNFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23O3P/c1-3-5-6-8-10(7-4-2)9-13-14(11)12/h10-12H,3-9H2,1-2H3.
What are the key properties of 2-propylheptyl dihydrogen phosphite?
2-propylheptyl dihydrogen phosphite has a molecular weight of 222.26 g/mol, XLogP of 3.21, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylheptyl dihydrogen phosphite is sourced from PubChem (CID 87359174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).