About pentyl dihydrogen phosphite;zinc
pentyl dihydrogen phosphite;zinc (PubChem CID 88839337) has the molecular formula C5H13O3PZn
and a molecular weight of 217.52 g/mol. Its IUPAC name is pentyl dihydrogen phosphite;zinc.
Molecular Properties
| Compound Name | pentyl dihydrogen phosphite;zinc |
| PubChem CID | 88839337 |
| Molecular Formula | C5H13O3PZn |
| Molecular Weight | 217.52 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | pentyl dihydrogen phosphite;zinc |
| SMILES | CCCCCOP(O)O.[Zn] |
| InChI | InChI=1S/C5H13O3P.Zn/c1-2-3-4-5-8-9(6)7;/h6-7H,2-5H2,1H3; |
| InChIKey | YZUQTIUPYYHCKN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentyl dihydrogen phosphite;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl dihydrogen phosphite;zinc?
The IUPAC name of pentyl dihydrogen phosphite;zinc (CID 88839337) is pentyl dihydrogen phosphite;zinc.
What is the SMILES notation for pentyl dihydrogen phosphite;zinc?
The canonical SMILES for pentyl dihydrogen phosphite;zinc is CCCCCOP(O)O.[Zn].
What is the InChIKey of pentyl dihydrogen phosphite;zinc?
The InChIKey is YZUQTIUPYYHCKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13O3P.Zn/c1-2-3-4-5-8-9(6)7;/h6-7H,2-5H2,1H3;.
What are the key properties of pentyl dihydrogen phosphite;zinc?
pentyl dihydrogen phosphite;zinc has a molecular weight of 217.52 g/mol, XLogP of 1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl dihydrogen phosphite;zinc is sourced from PubChem (CID 88839337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).