About didecyl hydrogen phosphite
didecyl hydrogen phosphite (PubChem CID 14151265) has the molecular formula C20H43O3P
and a molecular weight of 362.54 g/mol. Its IUPAC name is didecyl hydrogen phosphite.
Molecular Properties
| Compound Name | didecyl hydrogen phosphite |
| PubChem CID | 14151265 |
| Molecular Formula | C20H43O3P |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | didecyl hydrogen phosphite |
| SMILES | CCCCCCCCCCOP(O)OCCCCCCCCCC |
| InChI | InChI=1S/C20H43O3P/c1-3-5-7-9-11-13-15-17-19-22-24(21)23-20-18-16-14-12-10-8-6-4-2/h21H,3-20H2,1-2H3 |
| InChIKey | WYPOCAVDDXABIF-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze didecyl hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl hydrogen phosphite?
The IUPAC name of didecyl hydrogen phosphite (CID 14151265) is didecyl hydrogen phosphite.
What is the SMILES notation for didecyl hydrogen phosphite?
The canonical SMILES for didecyl hydrogen phosphite is CCCCCCCCCCOP(O)OCCCCCCCCCC.
What is the InChIKey of didecyl hydrogen phosphite?
The InChIKey is WYPOCAVDDXABIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43O3P/c1-3-5-7-9-11-13-15-17-19-22-24(21)23-20-18-16-14-12-10-8-6-4-2/h21H,3-20H2,1-2H3.
What are the key properties of didecyl hydrogen phosphite?
didecyl hydrogen phosphite has a molecular weight of 362.54 g/mol, XLogP of 7.52, 20 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl hydrogen phosphite is sourced from PubChem (CID 14151265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).