didecyl hydrogen phosphite

C20H43O3P — CID 14151265

IUPACdidecyl hydrogen phosphite
SMILESCCCCCCCCCCOP(O)OCCCCCCCCCC
InChIInChI=1S/C20H43O3P/c1-3-5-7-9-11-13-15-17-19-22-24(21)23-20-18-16-14-12-10-8-6-4-2/h21H,3-20H2,1-2H3
InChIKeyWYPOCAVDDXABIF-UHFFFAOYSA-N
MW362.54 g/mol
LogP7.52
Rot. Bonds20

About didecyl hydrogen phosphite

didecyl hydrogen phosphite (PubChem CID 14151265) has the molecular formula C20H43O3P and a molecular weight of 362.54 g/mol. Its IUPAC name is didecyl hydrogen phosphite.

Molecular Properties

Compound Namedidecyl hydrogen phosphite
PubChem CID14151265
Molecular FormulaC20H43O3P
Molecular Weight362.54 g/mol
Exact Mass362.29
IUPAC Namedidecyl hydrogen phosphite
SMILESCCCCCCCCCCOP(O)OCCCCCCCCCC
InChIInChI=1S/C20H43O3P/c1-3-5-7-9-11-13-15-17-19-22-24(21)23-20-18-16-14-12-10-8-6-4-2/h21H,3-20H2,1-2H3
InChIKeyWYPOCAVDDXABIF-UHFFFAOYSA-N
XLogP7.52
TPSA38.69 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds20
Heavy Atoms24
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500362.54
LogP ≤ 57.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze didecyl hydrogen phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of didecyl hydrogen phosphite?
The IUPAC name of didecyl hydrogen phosphite (CID 14151265) is didecyl hydrogen phosphite.
What is the SMILES notation for didecyl hydrogen phosphite?
The canonical SMILES for didecyl hydrogen phosphite is CCCCCCCCCCOP(O)OCCCCCCCCCC.
What is the InChIKey of didecyl hydrogen phosphite?
The InChIKey is WYPOCAVDDXABIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43O3P/c1-3-5-7-9-11-13-15-17-19-22-24(21)23-20-18-16-14-12-10-8-6-4-2/h21H,3-20H2,1-2H3.
What are the key properties of didecyl hydrogen phosphite?
didecyl hydrogen phosphite has a molecular weight of 362.54 g/mol, XLogP of 7.52, 20 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl hydrogen phosphite is sourced from PubChem (CID 14151265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).