C6H17O9P3 — CID 21491714
2,2-bis(dihydroxyphosphanyloxymethyl)butyl dihydrogen phosphite (PubChem CID 21491714) has the molecular formula C6H17O9P3 and a molecular weight of 326.12 g/mol. Its IUPAC name is 2,2-bis(dihydroxyphosphanyloxymethyl)butyl dihydrogen phosphite.
| Compound Name | 2,2-bis(dihydroxyphosphanyloxymethyl)butyl dihydrogen phosphite |
|---|---|
| PubChem CID | 21491714 |
| Molecular Formula | C6H17O9P3 |
| Molecular Weight | 326.12 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2,2-bis(dihydroxyphosphanyloxymethyl)butyl dihydrogen phosphite |
| SMILES | CCC(COP(O)O)(COP(O)O)COP(O)O |
| InChI | InChI=1S/C6H17O9P3/c1-2-6(3-13-16(7)8,4-14-17(9)10)5-15-18(11)12/h7-12H,2-5H2,1H3 |
| InChIKey | FPEXQKBNOTWLGM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.12 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|