C12H26O6 — CID 87319009
1-[2,2-bis(1-hydroxyethoxymethyl)butoxy]ethanol (PubChem CID 87319009) has the molecular formula C12H26O6 and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-[2,2-bis(1-hydroxyethoxymethyl)butoxy]ethanol.
| Compound Name | 1-[2,2-bis(1-hydroxyethoxymethyl)butoxy]ethanol |
|---|---|
| PubChem CID | 87319009 |
| Molecular Formula | C12H26O6 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-[2,2-bis(1-hydroxyethoxymethyl)butoxy]ethanol |
| SMILES | CCC(COC(C)O)(COC(C)O)COC(C)O |
| InChI | InChI=1S/C12H26O6/c1-5-12(6-16-9(2)13,7-17-10(3)14)8-18-11(4)15/h9-11,13-15H,5-8H2,1-4H3 |
| InChIKey | PAOOTCMINUGZEG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|