C18H38O6 — CID 118403092
1-[2,2-bis(2-hydroxybutoxymethyl)butoxy]butan-2-ol (PubChem CID 118403092) has the molecular formula C18H38O6 and a molecular weight of 350.50 g/mol. Its IUPAC name is 1-[2,2-bis(2-hydroxybutoxymethyl)butoxy]butan-2-ol.
| Compound Name | 1-[2,2-bis(2-hydroxybutoxymethyl)butoxy]butan-2-ol |
|---|---|
| PubChem CID | 118403092 |
| Molecular Formula | C18H38O6 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 1-[2,2-bis(2-hydroxybutoxymethyl)butoxy]butan-2-ol |
| SMILES | CCC(O)COCC(CC)(COCC(O)CC)COCC(O)CC |
| InChI | InChI=1S/C18H38O6/c1-5-15(19)9-22-12-18(8-4,13-23-10-16(20)6-2)14-24-11-17(21)7-3/h15-17,19-21H,5-14H2,1-4H3 |
| InChIKey | JTWCELQXQPSHEX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |