C14H30O5 — CID 164930760
2,2-bis(2-hydroxybutoxymethyl)butan-1-ol (PubChem CID 164930760) has the molecular formula C14H30O5 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2,2-bis(2-hydroxybutoxymethyl)butan-1-ol.
| Compound Name | 2,2-bis(2-hydroxybutoxymethyl)butan-1-ol |
|---|---|
| PubChem CID | 164930760 |
| Molecular Formula | C14H30O5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2,2-bis(2-hydroxybutoxymethyl)butan-1-ol |
| SMILES | CCC(O)COCC(CC)(CO)COCC(O)CC |
| InChI | InChI=1S/C14H30O5/c1-4-12(16)7-18-10-14(6-3,9-15)11-19-8-13(17)5-2/h12-13,15-17H,4-11H2,1-3H3 |
| InChIKey | ZUVMCYXDMISPID-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |