C15H14NO3P — CID 175520669
(2-cyano-2,2-diphenylethyl) dihydrogen phosphite (PubChem CID 175520669) has the molecular formula C15H14NO3P and a molecular weight of 287.25 g/mol. Its IUPAC name is (2-cyano-2,2-diphenylethyl) dihydrogen phosphite.
| Compound Name | (2-cyano-2,2-diphenylethyl) dihydrogen phosphite |
|---|---|
| PubChem CID | 175520669 |
| Molecular Formula | C15H14NO3P |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (2-cyano-2,2-diphenylethyl) dihydrogen phosphite |
| SMILES | N#CC(COP(O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14NO3P/c16-11-15(12-19-20(17)18,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,17-18H,12H2 |
| InChIKey | SNOLRKALKUSMJP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|