C18H18N2O2 — CID 174189297
(4-cyano-4,4-diphenylbutan-2-yl)carbamic acid (PubChem CID 174189297) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is (4-cyano-4,4-diphenylbutan-2-yl)carbamic acid.
| Compound Name | (4-cyano-4,4-diphenylbutan-2-yl)carbamic acid |
|---|---|
| PubChem CID | 174189297 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (4-cyano-4,4-diphenylbutan-2-yl)carbamic acid |
| SMILES | CC(CC(C#N)(c1ccccc1)c1ccccc1)NC(=O)O |
| InChI | InChI=1S/C18H18N2O2/c1-14(20-17(21)22)12-18(13-19,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,20H,12H2,1H3,(H,21,22) |
| InChIKey | HFONLGODOKXKTB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |