C21H27ClN2 — CID 3032221
4-(diethylamino)-2,2-diphenylpentanenitrile;hydrochloride (PubChem CID 3032221) has the molecular formula C21H27ClN2 and a molecular weight of 342.91 g/mol. Its IUPAC name is 4-(diethylamino)-2,2-diphenylpentanenitrile;hydrochloride.
| Compound Name | 4-(diethylamino)-2,2-diphenylpentanenitrile;hydrochloride |
|---|---|
| PubChem CID | 3032221 |
| Molecular Formula | C21H27ClN2 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 4-(diethylamino)-2,2-diphenylpentanenitrile;hydrochloride |
| SMILES | CCN(CC)C(C)CC(C#N)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H26N2.ClH/c1-4-23(5-2)18(3)16-21(17-22,19-12-8-6-9-13-19)20-14-10-7-11-15-20;/h6-15,18H,4-5,16H2,1-3H3;1H |
| InChIKey | MOUUGMQUUBSAOF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |