C20H20O6P2 — CID 174926133
[2-(2-dihydroxyphosphanyloxy-1,1-diphenylethyl)phenyl] dihydrogen phosphite (PubChem CID 174926133) has the molecular formula C20H20O6P2 and a molecular weight of 418.32 g/mol. Its IUPAC name is [2-(2-dihydroxyphosphanyloxy-1,1-diphenylethyl)phenyl] dihydrogen phosphite.
| Compound Name | [2-(2-dihydroxyphosphanyloxy-1,1-diphenylethyl)phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 174926133 |
| Molecular Formula | C20H20O6P2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | [2-(2-dihydroxyphosphanyloxy-1,1-diphenylethyl)phenyl] dihydrogen phosphite |
| SMILES | OP(O)OCC(c1ccccc1)(c1ccccc1)c1ccccc1OP(O)O |
| InChI | InChI=1S/C20H20O6P2/c21-27(22)25-15-20(16-9-3-1-4-10-16,17-11-5-2-6-12-17)18-13-7-8-14-19(18)26-28(23)24/h1-14,21-24H,15H2 |
| InChIKey | CPRVOGACHMQWQU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|