C22H28O8P2S2 — CID 145166399
S-[3-(2-dihydroxyphosphanyloxyphenyl)-3-methylbutanoyl]sulfanyl 3-(2-dihydroxyphosphanyloxyphenyl)-3-methylbutanethioate (PubChem CID 145166399) has the molecular formula C22H28O8P2S2 and a molecular weight of 546.54 g/mol. Its IUPAC name is S-[3-(2-dihydroxyphosphanyloxyphenyl)-3-methylbutanoyl]sulfanyl 3-(2-dihydroxyphosphanyloxyphenyl)-3-methylbutanethioate.
| Compound Name | S-[3-(2-dihydroxyphosphanyloxyphenyl)-3-methylbutanoyl]sulfanyl 3-(2-dihydroxyphosphanyloxyphenyl)-3-methylbutanethioate |
|---|---|
| PubChem CID | 145166399 |
| Molecular Formula | C22H28O8P2S2 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | S-[3-(2-dihydroxyphosphanyloxyphenyl)-3-methylbutanoyl]sulfanyl 3-(2-dihydroxyphosphanyloxyphenyl)-3-methylbutanethioate |
| SMILES | CC(C)(CC(=O)SSC(=O)CC(C)(C)c1ccccc1OP(O)O)c1ccccc1OP(O)O |
| InChI | InChI=1S/C22H28O8P2S2/c1-21(2,15-9-5-7-11-17(15)29-31(25)26)13-19(23)33-34-20(24)14-22(3,4)16-10-6-8-12-18(16)30-32(27)28/h5-12,25-28H,13-14H2,1-4H3 |
| InChIKey | VQRWWLJZXJQZBH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|