About (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite
(2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite (PubChem CID 154036014) has the molecular formula C10H16O5P2
and a molecular weight of 278.18 g/mol. Its IUPAC name is (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite.
Molecular Properties
| Compound Name | (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite |
| PubChem CID | 154036014 |
| Molecular Formula | C10H16O5P2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite |
| SMILES | CC(C)(C)c1ccccc1OP(O)OP(O)O |
| InChI | InChI=1S/C10H16O5P2/c1-10(2,3)8-6-4-5-7-9(8)14-17(13)15-16(11)12/h4-7,11-13H,1-3H3 |
| InChIKey | WTBQHHMNCOSCIX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite?
The IUPAC name of (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite (CID 154036014) is (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite.
What is the SMILES notation for (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite?
The canonical SMILES for (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite is CC(C)(C)c1ccccc1OP(O)OP(O)O.
What is the InChIKey of (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite?
The InChIKey is WTBQHHMNCOSCIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5P2/c1-10(2,3)8-6-4-5-7-9(8)14-17(13)15-16(11)12/h4-7,11-13H,1-3H3.
What are the key properties of (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite?
(2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite has a molecular weight of 278.18 g/mol, XLogP of 2.81, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butylphenyl) dihydroxyphosphanyl hydrogen phosphite is sourced from PubChem (CID 154036014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).