About (2-tert-butylphenyl) N-phenylcarbamate
(2-tert-butylphenyl) N-phenylcarbamate (PubChem CID 681743) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is (2-tert-butylphenyl) N-phenylcarbamate.
Molecular Properties
| Compound Name | (2-tert-butylphenyl) N-phenylcarbamate |
| PubChem CID | 681743 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2-tert-butylphenyl) N-phenylcarbamate |
| SMILES | CC(C)(C)c1ccccc1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c1-17(2,3)14-11-7-8-12-15(14)20-16(19)18-13-9-5-4-6-10-13/h4-12H,1-3H3,(H,18,19) |
| InChIKey | YTOWVQQSNBKYDE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-tert-butylphenyl) N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butylphenyl) N-phenylcarbamate?
The IUPAC name of (2-tert-butylphenyl) N-phenylcarbamate (CID 681743) is (2-tert-butylphenyl) N-phenylcarbamate.
What is the SMILES notation for (2-tert-butylphenyl) N-phenylcarbamate?
The canonical SMILES for (2-tert-butylphenyl) N-phenylcarbamate is CC(C)(C)c1ccccc1OC(=O)Nc1ccccc1.
What is the InChIKey of (2-tert-butylphenyl) N-phenylcarbamate?
The InChIKey is YTOWVQQSNBKYDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-17(2,3)14-11-7-8-12-15(14)20-16(19)18-13-9-5-4-6-10-13/h4-12H,1-3H3,(H,18,19).
What are the key properties of (2-tert-butylphenyl) N-phenylcarbamate?
(2-tert-butylphenyl) N-phenylcarbamate has a molecular weight of 269.34 g/mol, XLogP of 4.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butylphenyl) N-phenylcarbamate is sourced from PubChem (CID 681743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).