C30H39O2P — CID 54542176
bis(2-tert-butylphenoxy)-(4-tert-butylphenyl)phosphane (PubChem CID 54542176) has the molecular formula C30H39O2P and a molecular weight of 462.61 g/mol. Its IUPAC name is bis(2-tert-butylphenoxy)-(4-tert-butylphenyl)phosphane.
| Compound Name | bis(2-tert-butylphenoxy)-(4-tert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 54542176 |
| Molecular Formula | C30H39O2P |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | bis(2-tert-butylphenoxy)-(4-tert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1ccc(P(Oc2ccccc2C(C)(C)C)Oc2ccccc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H39O2P/c1-28(2,3)22-18-20-23(21-19-22)33(31-26-16-12-10-14-24(26)29(4,5)6)32-27-17-13-11-15-25(27)30(7,8)9/h10-21H,1-9H3 |
| InChIKey | ZDZRBMVWTDYEGL-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|