C38H47O2P — CID 134479186
(2-tert-butyl-4-ethylphenoxy)-(2,4-ditert-butylphenoxy)-(4-phenylphenyl)phosphane (PubChem CID 134479186) has the molecular formula C38H47O2P and a molecular weight of 566.77 g/mol. Its IUPAC name is (2-tert-butyl-4-ethylphenoxy)-(2,4-ditert-butylphenoxy)-(4-phenylphenyl)phosphane.
| Compound Name | (2-tert-butyl-4-ethylphenoxy)-(2,4-ditert-butylphenoxy)-(4-phenylphenyl)phosphane |
|---|---|
| PubChem CID | 134479186 |
| Molecular Formula | C38H47O2P |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | (2-tert-butyl-4-ethylphenoxy)-(2,4-ditert-butylphenoxy)-(4-phenylphenyl)phosphane |
| SMILES | CCc1ccc(OP(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c2ccc(-c3ccccc3)cc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H47O2P/c1-11-27-17-23-34(32(25-27)37(5,6)7)39-41(31-21-18-29(19-22-31)28-15-13-12-14-16-28)40-35-24-20-30(36(2,3)4)26-33(35)38(8,9)10/h12-26H,11H2,1-10H3 |
| InChIKey | VAOOZCGQRYLKSD-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|