C69H94O4P2 — CID 134339602
[4-[4-[bis(2,4-ditert-butylphenoxy)phosphanylmethyl]phenyl]phenyl]-bis(2,4-ditert-butylphenoxy)phosphane (PubChem CID 134339602) has the molecular formula C69H94O4P2 and a molecular weight of 1049.45 g/mol. Its IUPAC name is [4-[4-[bis(2,4-ditert-butylphenoxy)phosphanylmethyl]phenyl]phenyl]-bis(2,4-ditert-butylphenoxy)phosphane.
| Compound Name | [4-[4-[bis(2,4-ditert-butylphenoxy)phosphanylmethyl]phenyl]phenyl]-bis(2,4-ditert-butylphenoxy)phosphane |
|---|---|
| PubChem CID | 134339602 |
| Molecular Formula | C69H94O4P2 |
| Molecular Weight | 1049.45 g/mol |
| Exact Mass | 1048.66 |
| IUPAC Name | [4-[4-[bis(2,4-ditert-butylphenoxy)phosphanylmethyl]phenyl]phenyl]-bis(2,4-ditert-butylphenoxy)phosphane |
| SMILES | CC(C)(C)c1ccc(OP(Cc2ccc(-c3ccc(P(Oc4ccc(C(C)(C)C)cc4C(C)(C)C)Oc4ccc(C(C)(C)C)cc4C(C)(C)C)cc3)cc2)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C69H94O4P2/c1-62(2,3)49-31-37-58(54(41-49)66(13,14)15)70-74(71-59-38-32-50(63(4,5)6)42-55(59)67(16,17)18)45-46-25-27-47(28-26-46)48-29-35-53(36-30-48)75(72-60-39-33-51(64(7,8)9)43-56(60)68(19,20)21)73-61-40-34-52(65(10,11)12)44-57(61)69(22,23)24/h25-44H,45H2,1-24H3 |
| InChIKey | VKFXYLPZWUZOAV-UHFFFAOYSA-N |
| XLogP | 20.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.45 |
| LogP ≤ 5 | 20.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|