C72H102O4P2 — CID 91487722
bis(2,4-ditert-butyl-5-methylphenoxy)-methylphosphane;(2,4-ditert-butyl-5-methylphenoxy)-(2,4-ditert-butylphenoxy)-(4-phenylphenyl)phosphane (PubChem CID 91487722) has the molecular formula C72H102O4P2 and a molecular weight of 1093.55 g/mol. Its IUPAC name is bis(2,4-ditert-butyl-5-methylphenoxy)-methylphosphane;(2,4-ditert-butyl-5-methylphenoxy)-(2,4-ditert-butylphenoxy)-(4-phenylphenyl)phosphane.
| Compound Name | bis(2,4-ditert-butyl-5-methylphenoxy)-methylphosphane;(2,4-ditert-butyl-5-methylphenoxy)-(2,4-ditert-butylphenoxy)-(4-phenylphenyl)phosphane |
|---|---|
| PubChem CID | 91487722 |
| Molecular Formula | C72H102O4P2 |
| Molecular Weight | 1093.55 g/mol |
| Exact Mass | 1092.73 |
| IUPAC Name | bis(2,4-ditert-butyl-5-methylphenoxy)-methylphosphane;(2,4-ditert-butyl-5-methylphenoxy)-(2,4-ditert-butylphenoxy)-(4-phenylphenyl)phosphane |
| SMILES | Cc1cc(OP(C)Oc2cc(C)c(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)cc1C(C)(C)C.Cc1cc(OP(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c2ccc(-c3ccccc3)cc2)c(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C41H53O2P.C31H49O2P/c1-28-25-37(35(41(11,12)13)27-33(28)39(5,6)7)43-44(32-22-19-30(20-23-32)29-17-15-14-16-18-29)42-36-24-21-31(38(2,3)4)26-34(36)40(8,9)10;1-20-16-26(24(30(9,10)11)18-22(20)28(3,4)5)32-34(15)33-27-17-21(2)23(29(6,7)8)19-25(27)31(12,13)14/h14-27H,1-13H3;16-19H,1-15H3 |
| InChIKey | GDUFZVQQRHNLAL-UHFFFAOYSA-N |
| XLogP | 21.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1093.55 |
| LogP ≤ 5 | 21.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|