C40H55O2P — CID 167052856
bis(2,4-ditert-butylphenoxy)-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phosphane (PubChem CID 167052856) has the molecular formula C40H55O2P and a molecular weight of 598.85 g/mol. Its IUPAC name is bis(2,4-ditert-butylphenoxy)-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phosphane.
| Compound Name | bis(2,4-ditert-butylphenoxy)-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 167052856 |
| Molecular Formula | C40H55O2P |
| Molecular Weight | 598.85 g/mol |
| Exact Mass | 598.39 |
| IUPAC Name | bis(2,4-ditert-butylphenoxy)-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phosphane |
| SMILES | C/C=C\C(=C/C)c1ccc(P(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C40H55O2P/c1-15-17-28(16-2)29-18-22-32(23-19-29)43(41-35-24-20-30(37(3,4)5)26-33(35)39(9,10)11)42-36-25-21-31(38(6,7)8)27-34(36)40(12,13)14/h15-27H,1-14H3/b17-15-,28-16+ |
| InChIKey | MCQHKFSJRRKAOS-HPPQUTHXSA-N |
| XLogP | 11.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.85 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|