C26H35BO — CID 145169498
(2,4-ditert-butylphenoxy)-methyl-[4-[(3Z)-penta-1,3-dien-2-yl]phenyl]borane (PubChem CID 145169498) has the molecular formula C26H35BO and a molecular weight of 374.38 g/mol. Its IUPAC name is (2,4-ditert-butylphenoxy)-methyl-[4-[(3Z)-penta-1,3-dien-2-yl]phenyl]borane.
| Compound Name | (2,4-ditert-butylphenoxy)-methyl-[4-[(3Z)-penta-1,3-dien-2-yl]phenyl]borane |
|---|---|
| PubChem CID | 145169498 |
| Molecular Formula | C26H35BO |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (2,4-ditert-butylphenoxy)-methyl-[4-[(3Z)-penta-1,3-dien-2-yl]phenyl]borane |
| SMILES | C=C(/C=C\C)c1ccc(B(C)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H35BO/c1-10-11-19(2)20-12-15-22(16-13-20)27(9)28-24-17-14-21(25(3,4)5)18-23(24)26(6,7)8/h10-18H,2H2,1,3-9H3/b11-10- |
| InChIKey | RKCRUJARJOOKIW-KHPPLWFESA-N |
| XLogP | 6.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|