C54H66O6P2Si — CID 58931579
[2-[[2-bis(2-tert-butylphenoxy)phosphanyloxyphenyl]-dimethylsilyl]phenyl] bis(2-tert-butylphenyl) phosphite (PubChem CID 58931579) has the molecular formula C54H66O6P2Si and a molecular weight of 901.15 g/mol. Its IUPAC name is [2-[[2-bis(2-tert-butylphenoxy)phosphanyloxyphenyl]-dimethylsilyl]phenyl] bis(2-tert-butylphenyl) phosphite.
| Compound Name | [2-[[2-bis(2-tert-butylphenoxy)phosphanyloxyphenyl]-dimethylsilyl]phenyl] bis(2-tert-butylphenyl) phosphite |
|---|---|
| PubChem CID | 58931579 |
| Molecular Formula | C54H66O6P2Si |
| Molecular Weight | 901.15 g/mol |
| Exact Mass | 900.41 |
| IUPAC Name | [2-[[2-bis(2-tert-butylphenoxy)phosphanyloxyphenyl]-dimethylsilyl]phenyl] bis(2-tert-butylphenyl) phosphite |
| SMILES | CC(C)(C)c1ccccc1OP(Oc1ccccc1C(C)(C)C)Oc1ccccc1[Si](C)(C)c1ccccc1OP(Oc1ccccc1C(C)(C)C)Oc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C54H66O6P2Si/c1-51(2,3)39-27-15-19-31-43(39)55-61(56-44-32-20-16-28-40(44)52(4,5)6)59-47-35-23-25-37-49(47)63(13,14)50-38-26-24-36-48(50)60-62(57-45-33-21-17-29-41(45)53(7,8)9)58-46-34-22-18-30-42(46)54(10,11)12/h15-38H,1-14H3 |
| InChIKey | ZPLIWHJPEZLEEP-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.15 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|