C55H64O5P2 — CID 20727373
[5-bis(2-tert-butylphenoxy)phosphanyl-9,9-dimethylxanthen-4-yl]-bis(2-tert-butylphenoxy)phosphane (PubChem CID 20727373) has the molecular formula C55H64O5P2 and a molecular weight of 867.06 g/mol. Its IUPAC name is [5-bis(2-tert-butylphenoxy)phosphanyl-9,9-dimethylxanthen-4-yl]-bis(2-tert-butylphenoxy)phosphane.
| Compound Name | [5-bis(2-tert-butylphenoxy)phosphanyl-9,9-dimethylxanthen-4-yl]-bis(2-tert-butylphenoxy)phosphane |
|---|---|
| PubChem CID | 20727373 |
| Molecular Formula | C55H64O5P2 |
| Molecular Weight | 867.06 g/mol |
| Exact Mass | 866.42 |
| IUPAC Name | [5-bis(2-tert-butylphenoxy)phosphanyl-9,9-dimethylxanthen-4-yl]-bis(2-tert-butylphenoxy)phosphane |
| SMILES | CC(C)(C)c1ccccc1OP(Oc1ccccc1C(C)(C)C)c1cccc2c1Oc1c(P(Oc3ccccc3C(C)(C)C)Oc3ccccc3C(C)(C)C)cccc1C2(C)C |
| InChI | InChI=1S/C55H64O5P2/c1-51(2,3)37-25-15-19-31-43(37)57-61(58-44-32-20-16-26-38(44)52(4,5)6)47-35-23-29-41-49(47)56-50-42(55(41,13)14)30-24-36-48(50)62(59-45-33-21-17-27-39(45)53(7,8)9)60-46-34-22-18-28-40(46)54(10,11)12/h15-36H,1-14H3 |
| InChIKey | UYSIZOGSYRGHAA-UHFFFAOYSA-N |
| XLogP | 15.50 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.06 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|