C41H36O3P2 — CID 138732432
(3-methoxyphenyl)-[5-[(3-methoxyphenyl)-phenylphosphanyl]-9,9-dimethylxanthen-4-yl]-phenylphosphane (PubChem CID 138732432) has the molecular formula C41H36O3P2 and a molecular weight of 638.68 g/mol. Its IUPAC name is (3-methoxyphenyl)-[5-[(3-methoxyphenyl)-phenylphosphanyl]-9,9-dimethylxanthen-4-yl]-phenylphosphane.
| Compound Name | (3-methoxyphenyl)-[5-[(3-methoxyphenyl)-phenylphosphanyl]-9,9-dimethylxanthen-4-yl]-phenylphosphane |
|---|---|
| PubChem CID | 138732432 |
| Molecular Formula | C41H36O3P2 |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | (3-methoxyphenyl)-[5-[(3-methoxyphenyl)-phenylphosphanyl]-9,9-dimethylxanthen-4-yl]-phenylphosphane |
| SMILES | COc1cccc([P@](c2ccccc2)c2cccc3c2Oc2c([P@@](c4ccccc4)c4cccc(OC)c4)cccc2C3(C)C)c1 |
| InChI | InChI=1S/C41H36O3P2/c1-41(2)35-23-13-25-37(45(31-17-7-5-8-18-31)33-21-11-15-29(27-33)42-3)39(35)44-40-36(41)24-14-26-38(40)46(32-19-9-6-10-20-32)34-22-12-16-30(28-34)43-4/h5-28H,1-4H3/t45-,46-/m0/s1 |
| InChIKey | GTUVLPCCSLFDTJ-ZYBCLOSLSA-N |
| XLogP | 7.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|