C41H35NO2P2 — CID 122478627
2-[4,5-bis(diphenylphosphanyl)-9,9-dimethylxanthen-1-yl]acetamide (PubChem CID 122478627) has the molecular formula C41H35NO2P2 and a molecular weight of 635.68 g/mol. Its IUPAC name is 2-[4,5-bis(diphenylphosphanyl)-9,9-dimethylxanthen-1-yl]acetamide.
| Compound Name | 2-[4,5-bis(diphenylphosphanyl)-9,9-dimethylxanthen-1-yl]acetamide |
|---|---|
| PubChem CID | 122478627 |
| Molecular Formula | C41H35NO2P2 |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.21 |
| IUPAC Name | 2-[4,5-bis(diphenylphosphanyl)-9,9-dimethylxanthen-1-yl]acetamide |
| SMILES | CC1(C)c2cccc(P(c3ccccc3)c3ccccc3)c2Oc2c(P(c3ccccc3)c3ccccc3)ccc(CC(N)=O)c21 |
| InChI | InChI=1S/C41H35NO2P2/c1-41(2)34-24-15-25-35(45(30-16-7-3-8-17-30)31-18-9-4-10-19-31)39(34)44-40-36(27-26-29(38(40)41)28-37(42)43)46(32-20-11-5-12-21-32)33-22-13-6-14-23-33/h3-27H,28H2,1-2H3,(H2,42,43) |
| InChIKey | VWQWKSGOEIPETI-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|