C38H35N3OP2 — CID 139401730
(1Z,3E,5Z)-1-[(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-phenylphosphanyl]-5-hydrazinylidenepenta-1,3-dien-3-amine (PubChem CID 139401730) has the molecular formula C38H35N3OP2 and a molecular weight of 611.67 g/mol. Its IUPAC name is (1Z,3E,5Z)-1-[(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-phenylphosphanyl]-5-hydrazinylidenepenta-1,3-dien-3-amine.
| Compound Name | (1Z,3E,5Z)-1-[(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-phenylphosphanyl]-5-hydrazinylidenepenta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 139401730 |
| Molecular Formula | C38H35N3OP2 |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | (1Z,3E,5Z)-1-[(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-phenylphosphanyl]-5-hydrazinylidenepenta-1,3-dien-3-amine |
| SMILES | CC1(C)c2cccc(P(/C=C\C(N)=C/C=N\N)c3ccccc3)c2Oc2c(P(c3ccccc3)c3ccccc3)cccc21 |
| InChI | InChI=1S/C38H35N3OP2/c1-38(2)32-20-12-22-34(43(29-14-6-3-7-15-29)27-25-28(39)24-26-41-40)36(32)42-37-33(38)21-13-23-35(37)44(30-16-8-4-9-17-30)31-18-10-5-11-19-31/h3-27H,39-40H2,1-2H3/b27-25-,28-24+,41-26- |
| InChIKey | VMTRFKUUGLPRLL-LQJBYIBISA-N |
| XLogP | 6.61 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|