C50H40BrCuN2OP2 — CID 171365133
N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;copper(1+);(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-diphenylphosphane (PubChem CID 171365133) has the molecular formula C50H40BrCuN2OP2 and a molecular weight of 890.28 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;copper(1+);(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-diphenylphosphane.
| Compound Name | N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;copper(1+);(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 171365133 |
| Molecular Formula | C50H40BrCuN2OP2 |
| Molecular Weight | 890.28 g/mol |
| Exact Mass | 888.11 |
| IUPAC Name | N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;copper(1+);(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-diphenylphosphane |
| SMILES | Brc1ccc(/N=C/c2ccc[n-]2)cc1.CC1(C)c2cccc(P(c3ccccc3)c3ccccc3)c2Oc2c(P(c3ccccc3)c3ccccc3)cccc21.[Cu+] |
| InChI | InChI=1S/C39H32OP2.C11H8BrN2.Cu/c1-39(2)33-25-15-27-35(41(29-17-7-3-8-18-29)30-19-9-4-10-20-30)37(33)40-38-34(39)26-16-28-36(38)42(31-21-11-5-12-22-31)32-23-13-6-14-24-32;12-9-3-5-10(6-4-9)14-8-11-2-1-7-13-11;/h3-28H,1-2H3;1-8H;/q;-1;+1/b;14-8+; |
| InChIKey | LYCVEUSFVISIMN-TXTNVABFSA-N |
| XLogP | 10.79 |
| TPSA | 35.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.28 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|