C40H34OP2 — CID 143050701
(4-diphenylphosphanyl-11,11-dimethyl-10H-cyclohepta[b]chromen-6-yl)-diphenylphosphane (PubChem CID 143050701) has the molecular formula C40H34OP2 and a molecular weight of 592.66 g/mol. Its IUPAC name is (4-diphenylphosphanyl-11,11-dimethyl-10H-cyclohepta[b]chromen-6-yl)-diphenylphosphane.
| Compound Name | (4-diphenylphosphanyl-11,11-dimethyl-10H-cyclohepta[b]chromen-6-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 143050701 |
| Molecular Formula | C40H34OP2 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | (4-diphenylphosphanyl-11,11-dimethyl-10H-cyclohepta[b]chromen-6-yl)-diphenylphosphane |
| SMILES | CC1(C)C2=C(Oc3c(P(c4ccccc4)c4ccccc4)cccc31)C(P(c1ccccc1)c1ccccc1)=CC=CC2 |
| InChI | InChI=1S/C40H34OP2/c1-40(2)34-26-15-16-28-36(42(30-18-7-3-8-19-30)31-20-9-4-10-21-31)38(34)41-39-35(40)27-17-29-37(39)43(32-22-11-5-12-23-32)33-24-13-6-14-25-33/h3-25,27-29H,26H2,1-2H3 |
| InChIKey | BJNPQAMDFQJXBQ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|