C42H45O3P — CID 19087278
tris(3-tert-butylnaphthalen-2-yl) phosphite (PubChem CID 19087278) has the molecular formula C42H45O3P and a molecular weight of 628.79 g/mol. Its IUPAC name is tris(3-tert-butylnaphthalen-2-yl) phosphite.
| Compound Name | tris(3-tert-butylnaphthalen-2-yl) phosphite |
|---|---|
| PubChem CID | 19087278 |
| Molecular Formula | C42H45O3P |
| Molecular Weight | 628.79 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | tris(3-tert-butylnaphthalen-2-yl) phosphite |
| SMILES | CC(C)(C)c1cc2ccccc2cc1OP(Oc1cc2ccccc2cc1C(C)(C)C)Oc1cc2ccccc2cc1C(C)(C)C |
| InChI | InChI=1S/C42H45O3P/c1-40(2,3)34-22-28-16-10-13-19-31(28)25-37(34)43-46(44-38-26-32-20-14-11-17-29(32)23-35(38)41(4,5)6)45-39-27-33-21-15-12-18-30(33)24-36(39)42(7,8)9/h10-27H,1-9H3 |
| InChIKey | QKLOMIAQFKHJJW-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.79 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|