About (2-tritylphenyl) dihydrogen phosphite
(2-tritylphenyl) dihydrogen phosphite (PubChem CID 175343429) has the molecular formula C25H21O3P
and a molecular weight of 400.41 g/mol. Its IUPAC name is (2-tritylphenyl) dihydrogen phosphite.
Molecular Properties
| Compound Name | (2-tritylphenyl) dihydrogen phosphite |
| PubChem CID | 175343429 |
| Molecular Formula | C25H21O3P |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (2-tritylphenyl) dihydrogen phosphite |
| SMILES | OP(O)Oc1ccccc1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21O3P/c26-29(27)28-24-19-11-10-18-23(24)25(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19,26-27H |
| InChIKey | OJYTVJYNJZNXIL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (2-tritylphenyl) dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tritylphenyl) dihydrogen phosphite?
The IUPAC name of (2-tritylphenyl) dihydrogen phosphite (CID 175343429) is (2-tritylphenyl) dihydrogen phosphite.
What is the SMILES notation for (2-tritylphenyl) dihydrogen phosphite?
The canonical SMILES for (2-tritylphenyl) dihydrogen phosphite is OP(O)Oc1ccccc1C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2-tritylphenyl) dihydrogen phosphite?
The InChIKey is OJYTVJYNJZNXIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21O3P/c26-29(27)28-24-19-11-10-18-23(24)25(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19,26-27H.
What are the key properties of (2-tritylphenyl) dihydrogen phosphite?
(2-tritylphenyl) dihydrogen phosphite has a molecular weight of 400.41 g/mol, XLogP of 5.66, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tritylphenyl) dihydrogen phosphite is sourced from PubChem (CID 175343429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).