C11H13O5PS-2 — CID 145166409
[2-(2-methyl-4-oxo-4-sulfanylbutan-2-yl)phenyl] phosphate (PubChem CID 145166409) has the molecular formula C11H13O5PS-2 and a molecular weight of 288.26 g/mol. Its IUPAC name is [2-(2-methyl-4-oxo-4-sulfanylbutan-2-yl)phenyl] phosphate.
| Compound Name | [2-(2-methyl-4-oxo-4-sulfanylbutan-2-yl)phenyl] phosphate |
|---|---|
| PubChem CID | 145166409 |
| Molecular Formula | C11H13O5PS-2 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | [2-(2-methyl-4-oxo-4-sulfanylbutan-2-yl)phenyl] phosphate |
| SMILES | CC(C)(CC(=O)S)c1ccccc1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C11H15O5PS/c1-11(2,7-10(12)18)8-5-3-4-6-9(8)16-17(13,14)15/h3-6H,7H2,1-2H3,(H,12,18)(H2,13,14,15)/p-2 |
| InChIKey | RFYWCRRFEWDRPY-UHFFFAOYSA-L |
| XLogP | 1.02 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|