C16H19O5PS — CID 134479334
3-methyl-3-[3-(phosphonooxymethyl)naphthalen-2-yl]butanethioic S-acid (PubChem CID 134479334) has the molecular formula C16H19O5PS and a molecular weight of 354.36 g/mol. Its IUPAC name is 3-methyl-3-[3-(phosphonooxymethyl)naphthalen-2-yl]butanethioic S-acid.
| Compound Name | 3-methyl-3-[3-(phosphonooxymethyl)naphthalen-2-yl]butanethioic S-acid |
|---|---|
| PubChem CID | 134479334 |
| Molecular Formula | C16H19O5PS |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-methyl-3-[3-(phosphonooxymethyl)naphthalen-2-yl]butanethioic S-acid |
| SMILES | CC(C)(CC(=O)S)c1cc2ccccc2cc1COP(=O)(O)O |
| InChI | InChI=1S/C16H19O5PS/c1-16(2,9-15(17)23)14-8-12-6-4-3-5-11(12)7-13(14)10-21-22(18,19)20/h3-8H,9-10H2,1-2H3,(H,17,23)(H2,18,19,20) |
| InChIKey | XNNIHOVYOWSGQR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|