C24H32O10P2S2 — CID 134472806
S-[3-(2,4-dimethyl-6-phosphonooxyphenyl)-3-methylbutanoyl]sulfanyl 3-methyl-3-(2-phosphonooxyphenyl)butanethioate (PubChem CID 134472806) has the molecular formula C24H32O10P2S2 and a molecular weight of 606.59 g/mol. Its IUPAC name is S-[3-(2,4-dimethyl-6-phosphonooxyphenyl)-3-methylbutanoyl]sulfanyl 3-methyl-3-(2-phosphonooxyphenyl)butanethioate.
| Compound Name | S-[3-(2,4-dimethyl-6-phosphonooxyphenyl)-3-methylbutanoyl]sulfanyl 3-methyl-3-(2-phosphonooxyphenyl)butanethioate |
|---|---|
| PubChem CID | 134472806 |
| Molecular Formula | C24H32O10P2S2 |
| Molecular Weight | 606.59 g/mol |
| Exact Mass | 606.09 |
| IUPAC Name | S-[3-(2,4-dimethyl-6-phosphonooxyphenyl)-3-methylbutanoyl]sulfanyl 3-methyl-3-(2-phosphonooxyphenyl)butanethioate |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)SSC(=O)CC(C)(C)c2ccccc2OP(=O)(O)O)c(OP(=O)(O)O)c1 |
| InChI | InChI=1S/C24H32O10P2S2/c1-15-11-16(2)22(19(12-15)34-36(30,31)32)24(5,6)14-21(26)38-37-20(25)13-23(3,4)17-9-7-8-10-18(17)33-35(27,28)29/h7-12H,13-14H2,1-6H3,(H2,27,28,29)(H2,30,31,32) |
| InChIKey | YEMXOMLDZHKYCC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|