[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid

C9H19O9P — CID 88820823

IUPAC[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid
SMILESCC(=O)CC(=O)O.OCC(CO)(CO)COP(O)O
InChIInChI=1S/C5H13O6P.C4H6O3/c6-1-5(2-7,3-8)4-11-12(9)10;1-3(5)2-4(6)7/h6-10H,1-4H2;2H2,1H3,(H,6,7)
InChIKeyQCEPBLYEWUSQMX-UHFFFAOYSA-N
MW302.22 g/mol
LogP-1.77
Rot. Bonds8

About [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid

[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid (PubChem CID 88820823) has the molecular formula C9H19O9P and a molecular weight of 302.22 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid.

Molecular Properties

Compound Name[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid
PubChem CID88820823
Molecular FormulaC9H19O9P
Molecular Weight302.22 g/mol
Exact Mass302.08
IUPAC Name[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid
SMILESCC(=O)CC(=O)O.OCC(CO)(CO)COP(O)O
InChIInChI=1S/C5H13O6P.C4H6O3/c6-1-5(2-7,3-8)4-11-12(9)10;1-3(5)2-4(6)7/h6-10H,1-4H2;2H2,1H3,(H,6,7)
InChIKeyQCEPBLYEWUSQMX-UHFFFAOYSA-N
XLogP-1.77
TPSA164.75 Ų
H-Bond Donors6
H-Bond Acceptors8
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500302.22
LogP ≤ 5-1.77
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid?
The IUPAC name of [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid (CID 88820823) is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid.
What is the SMILES notation for [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid?
The canonical SMILES for [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid is CC(=O)CC(=O)O.OCC(CO)(CO)COP(O)O.
What is the InChIKey of [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid?
The InChIKey is QCEPBLYEWUSQMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13O6P.C4H6O3/c6-1-5(2-7,3-8)4-11-12(9)10;1-3(5)2-4(6)7/h6-10H,1-4H2;2H2,1H3,(H,6,7).
What are the key properties of [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid?
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid has a molecular weight of 302.22 g/mol, XLogP of -1.77, 8 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid is sourced from PubChem (CID 88820823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).