C9H19O9P — CID 88820823
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid (PubChem CID 88820823) has the molecular formula C9H19O9P and a molecular weight of 302.22 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid |
|---|---|
| PubChem CID | 88820823 |
| Molecular Formula | C9H19O9P |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;3-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)O.OCC(CO)(CO)COP(O)O |
| InChI | InChI=1S/C5H13O6P.C4H6O3/c6-1-5(2-7,3-8)4-11-12(9)10;1-3(5)2-4(6)7/h6-10H,1-4H2;2H2,1H3,(H,6,7) |
| InChIKey | QCEPBLYEWUSQMX-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|