C35H52O9P2 — CID 175739061
dihydroxyphosphanyl dihydrogen phosphite;1,1,3-tris(4-tert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol (PubChem CID 175739061) has the molecular formula C35H52O9P2 and a molecular weight of 678.74 g/mol. Its IUPAC name is dihydroxyphosphanyl dihydrogen phosphite;1,1,3-tris(4-tert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol.
| Compound Name | dihydroxyphosphanyl dihydrogen phosphite;1,1,3-tris(4-tert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 175739061 |
| Molecular Formula | C35H52O9P2 |
| Molecular Weight | 678.74 g/mol |
| Exact Mass | 678.31 |
| IUPAC Name | dihydroxyphosphanyl dihydrogen phosphite;1,1,3-tris(4-tert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol |
| SMILES | CC(C)(C)c1ccc(C(O)C(CO)(CO)C(O)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1.OP(O)OP(O)O |
| InChI | InChI=1S/C35H48O4.H4O5P2/c1-31(2,3)25-12-10-24(11-13-25)30(38)34(22-36,23-37)35(39,28-18-14-26(15-19-28)32(4,5)6)29-20-16-27(17-21-29)33(7,8)9;1-6(2)5-7(3)4/h10-21,30,36-39H,22-23H2,1-9H3;1-4H |
| InChIKey | REFDVQKEYXRDCW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.74 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|