C111H171O3P — CID 140616402
tris[2-[2-tert-butyl-4-(2-methylbut-3-en-2-yl)phenyl]-2-(2,4-ditert-butylphenyl)octyl] phosphite (PubChem CID 140616402) has the molecular formula C111H171O3P and a molecular weight of 1584.56 g/mol. Its IUPAC name is tris[2-[2-tert-butyl-4-(2-methylbut-3-en-2-yl)phenyl]-2-(2,4-ditert-butylphenyl)octyl] phosphite.
| Compound Name | tris[2-[2-tert-butyl-4-(2-methylbut-3-en-2-yl)phenyl]-2-(2,4-ditert-butylphenyl)octyl] phosphite |
|---|---|
| PubChem CID | 140616402 |
| Molecular Formula | C111H171O3P |
| Molecular Weight | 1584.56 g/mol |
| Exact Mass | 1583.30 |
| IUPAC Name | tris[2-[2-tert-butyl-4-(2-methylbut-3-en-2-yl)phenyl]-2-(2,4-ditert-butylphenyl)octyl] phosphite |
| SMILES | C=CC(C)(C)c1ccc(C(CCCCCC)(COP(OCC(CCCCCC)(c2ccc(C(C)(C)C)cc2C(C)(C)C)c2ccc(C(C)(C)C=C)cc2C(C)(C)C)OCC(CCCCCC)(c2ccc(C(C)(C)C)cc2C(C)(C)C)c2ccc(C(C)(C)C=C)cc2C(C)(C)C)c2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C111H171O3P/c1-40-46-49-52-67-109(85-61-55-79(97(7,8)9)70-91(85)100(16,17)18,88-64-58-82(106(34,35)43-4)73-94(88)103(25,26)27)76-112-115(113-77-110(68-53-50-47-41-2,86-62-56-80(98(10,11)12)71-92(86)101(19,20)21)89-65-59-83(107(36,37)44-5)74-95(89)104(28,29)30)114-78-111(69-54-51-48-42-3,87-63-57-81(99(13,14)15)72-93(87)102(22,23)24)90-66-60-84(108(38,39)45-6)75-96(90)105(31,32)33/h43-45,55-66,70-75H,4-6,40-42,46-54,67-69,76-78H2,1-3,7-39H3 |
| InChIKey | VATYJENCXMLXJO-UHFFFAOYSA-N |
| XLogP | 33.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 115 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1584.56 |
| LogP ≤ 5 | 33.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|