C27H36O2 — CID 139760589
4-[2-(4-hydroxy-3-prop-2-enylphenyl)nonan-2-yl]-2-prop-2-enylphenol (PubChem CID 139760589) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is 4-[2-(4-hydroxy-3-prop-2-enylphenyl)nonan-2-yl]-2-prop-2-enylphenol.
| Compound Name | 4-[2-(4-hydroxy-3-prop-2-enylphenyl)nonan-2-yl]-2-prop-2-enylphenol |
|---|---|
| PubChem CID | 139760589 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 4-[2-(4-hydroxy-3-prop-2-enylphenyl)nonan-2-yl]-2-prop-2-enylphenol |
| SMILES | C=CCc1cc(C(C)(CCCCCCC)c2ccc(O)c(CC=C)c2)ccc1O |
| InChI | InChI=1S/C27H36O2/c1-5-8-9-10-11-18-27(4,23-14-16-25(28)21(19-23)12-6-2)24-15-17-26(29)22(20-24)13-7-3/h6-7,14-17,19-20,28-29H,2-3,5,8-13,18H2,1,4H3 |
| InChIKey | XEHQUXLZASOVTG-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|